C27H56N3O5S2+ — CID 118569094
2-[2-[2-[(3R,8S)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfanyl]pentadecan-8-yl]sulfanylethoxy]ethoxy]ethylimino-iminoazanium (PubChem CID 118569094) has the molecular formula C27H56N3O5S2+ and a molecular weight of 566.90 g/mol. Its IUPAC name is 2-[2-[2-[(3R,8S)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfanyl]pentadecan-8-yl]sulfanylethoxy]ethoxy]ethylimino-iminoazanium.
| Compound Name | 2-[2-[2-[(3R,8S)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfanyl]pentadecan-8-yl]sulfanylethoxy]ethoxy]ethylimino-iminoazanium |
|---|---|
| PubChem CID | 118569094 |
| Molecular Formula | C27H56N3O5S2+ |
| Molecular Weight | 566.90 g/mol |
| Exact Mass | 566.37 |
| IUPAC Name | 2-[2-[2-[(3R,8S)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfanyl]pentadecan-8-yl]sulfanylethoxy]ethoxy]ethylimino-iminoazanium |
| SMILES | CCCCCCC[C@@H](CCCCC(CC)SCCOCCOCCO)SCCOCCOCCN=[N+]=N |
| InChI | InChI=1S/C27H56N3O5S2/c1-3-5-6-7-8-12-27(37-25-23-34-20-18-32-16-14-29-30-28)13-10-9-11-26(4-2)36-24-22-35-21-19-33-17-15-31/h26-28,31H,3-25H2,1-2H3/q+1/t26?,27-/m0/s1 |
| InChIKey | DCMDJNVCXRJNLG-GEVKEYJPSA-N |
| XLogP | 6.13 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.90 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|