C32H24F3N3O — CID 11856960
3-benzyl-4-[3-[(1-methylindol-7-yl)methoxy]phenyl]-8-(trifluoromethyl)cinnoline (PubChem CID 11856960) has the molecular formula C32H24F3N3O and a molecular weight of 523.56 g/mol. Its IUPAC name is 3-benzyl-4-[3-[(1-methylindol-7-yl)methoxy]phenyl]-8-(trifluoromethyl)cinnoline.
| Compound Name | 3-benzyl-4-[3-[(1-methylindol-7-yl)methoxy]phenyl]-8-(trifluoromethyl)cinnoline |
|---|---|
| PubChem CID | 11856960 |
| Molecular Formula | C32H24F3N3O |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 3-benzyl-4-[3-[(1-methylindol-7-yl)methoxy]phenyl]-8-(trifluoromethyl)cinnoline |
| SMILES | Cn1ccc2cccc(COc3cccc(-c4c(Cc5ccccc5)nnc5c(C(F)(F)F)cccc45)c3)c21 |
| InChI | InChI=1S/C32H24F3N3O/c1-38-17-16-22-10-5-12-24(31(22)38)20-39-25-13-6-11-23(19-25)29-26-14-7-15-27(32(33,34)35)30(26)37-36-28(29)18-21-8-3-2-4-9-21/h2-17,19H,18,20H2,1H3 |
| InChIKey | QJFZBMOXZHRSFQ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |