About 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide
3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide (PubChem CID 118569601) has the molecular formula C15H20Cl2N2O2
and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide |
| PubChem CID | 118569601 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide |
| SMILES | ON/C(CC(O)C1CCCCC1)=N\c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c16-11-6-12(17)8-13(7-11)18-15(19-21)9-14(20)10-4-2-1-3-5-10/h6-8,10,14,20-21H,1-5,9H2,(H,18,19) |
| InChIKey | ZXJFYCSFLZWWDA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide?
The IUPAC name of 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide (CID 118569601) is 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide.
What is the SMILES notation for 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide?
The canonical SMILES for 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide is ON/C(CC(O)C1CCCCC1)=N\c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide?
The InChIKey is ZXJFYCSFLZWWDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2N2O2/c16-11-6-12(17)8-13(7-11)18-15(19-21)9-14(20)10-4-2-1-3-5-10/h6-8,10,14,20-21H,1-5,9H2,(H,18,19).
What are the key properties of 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide?
3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide has a molecular weight of 331.24 g/mol, XLogP of 4.33, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-N'-(3,5-dichlorophenyl)-N,3-dihydroxypropanimidamide is sourced from PubChem (CID 118569601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).