C13H14F2O12S — CID 118569884
1,1-difluoro-2-[[(1S,2R,6R,8S,9S)-4-(2-methoxy-2-oxoethyl)-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl]oxy]-2-oxoethanesulfonic acid (PubChem CID 118569884) has the molecular formula C13H14F2O12S and a molecular weight of 432.31 g/mol. Its IUPAC name is 1,1-difluoro-2-[[(1S,2R,6R,8S,9S)-4-(2-methoxy-2-oxoethyl)-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[(1S,2R,6R,8S,9S)-4-(2-methoxy-2-oxoethyl)-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 118569884 |
| Molecular Formula | C13H14F2O12S |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1,1-difluoro-2-[[(1S,2R,6R,8S,9S)-4-(2-methoxy-2-oxoethyl)-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl]oxy]-2-oxoethanesulfonic acid |
| SMILES | COC(=O)CC1(C)O[C@H]2O[C@H]3[C@H](OC(=O)[C@H]3OC(=O)C(F)(F)S(=O)(=O)O)[C@H]2O1 |
| InChI | InChI=1S/C13H14F2O12S/c1-12(3-4(16)22-2)26-8-6-5(24-10(8)27-12)7(9(17)23-6)25-11(18)13(14,15)28(19,20)21/h5-8,10H,3H2,1-2H3,(H,19,20,21)/t5-,6-,7-,8+,10+,12?/m0/s1 |
| InChIKey | PYAHTPRJEQOKEC-RAIZKPTKSA-N |
| XLogP | -1.28 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|