About N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine
N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine (PubChem CID 118569953) has the molecular formula C17H23N2+
and a molecular weight of 255.39 g/mol. Its IUPAC name is N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine |
| PubChem CID | 118569953 |
| Molecular Formula | C17H23N2+ |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine |
| SMILES | CN(c1cc[n+](C)c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C17H23N2/c1-18-13-12-17(15-10-6-7-11-16(15)18)19(2)14-8-4-3-5-9-14/h6-7,10-14H,3-5,8-9H2,1-2H3/q+1 |
| InChIKey | WDWMBNZNOHDAHU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine?
The IUPAC name of N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine (CID 118569953) is N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine.
What is the SMILES notation for N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine?
The canonical SMILES for N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine is CN(c1cc[n+](C)c2ccccc12)C1CCCCC1.
What is the InChIKey of N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine?
The InChIKey is WDWMBNZNOHDAHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N2/c1-18-13-12-17(15-10-6-7-11-16(15)18)19(2)14-8-4-3-5-9-14/h6-7,10-14H,3-5,8-9H2,1-2H3/q+1.
What are the key properties of N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine?
N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine has a molecular weight of 255.39 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N,1-dimethylquinolin-1-ium-4-amine is sourced from PubChem (CID 118569953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).