About tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate
tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate (PubChem CID 118570141) has the molecular formula C24H26FN3O2
and a molecular weight of 407.49 g/mol. Its IUPAC name is tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate |
| PubChem CID | 118570141 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(-c3ccccc3)nn(Cc3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C24H26FN3O2/c1-24(2,3)30-23(29)27-14-13-20-21(16-27)28(15-17-9-11-19(25)12-10-17)26-22(20)18-7-5-4-6-8-18/h4-12H,13-16H2,1-3H3 |
| InChIKey | YHXGJLMYBSKHSJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate?
The IUPAC name of tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate (CID 118570141) is tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate.
What is the SMILES notation for tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate?
The canonical SMILES for tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate is CC(C)(C)OC(=O)N1CCc2c(-c3ccccc3)nn(Cc3ccc(F)cc3)c2C1.
What is the InChIKey of tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate?
The InChIKey is YHXGJLMYBSKHSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26FN3O2/c1-24(2,3)30-23(29)27-14-13-20-21(16-27)28(15-17-9-11-19(25)12-10-17)26-22(20)18-7-5-4-6-8-18/h4-12H,13-16H2,1-3H3.
What are the key properties of tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate?
tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate has a molecular weight of 407.49 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1-[(4-fluorophenyl)methyl]-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridine-6-carboxylate is sourced from PubChem (CID 118570141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).