C19H24N4O5 — CID 118570508
[(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]carbamate (PubChem CID 118570508) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]carbamate.
| Compound Name | [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 118570508 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]carbamate |
| SMILES | CC(C)(C)c1nc(CCNC(=O)O[C@@]2(O)CCN(c3ccccc3)C2=O)no1 |
| InChI | InChI=1S/C19H24N4O5/c1-18(2,3)15-21-14(22-28-15)9-11-20-17(25)27-19(26)10-12-23(16(19)24)13-7-5-4-6-8-13/h4-8,26H,9-12H2,1-3H3,(H,20,25)/t19-/m0/s1 |
| InChIKey | ZVLCOWFFEYYKCD-IBGZPJMESA-N |
| XLogP | 1.76 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|