About 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide
2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide (PubChem CID 118570581) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide |
| PubChem CID | 118570581 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide |
| SMILES | CC(C)(C)c1nc(CC(N)=O)no1 |
| InChI | InChI=1S/C8H13N3O2/c1-8(2,3)7-10-6(11-13-7)4-5(9)12/h4H2,1-3H3,(H2,9,12) |
| InChIKey | VSXFIJFGWAPUTF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide?
The IUPAC name of 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide (CID 118570581) is 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide.
What is the SMILES notation for 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide?
The canonical SMILES for 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide is CC(C)(C)c1nc(CC(N)=O)no1.
What is the InChIKey of 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide?
The InChIKey is VSXFIJFGWAPUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-8(2,3)7-10-6(11-13-7)4-5(9)12/h4H2,1-3H3,(H2,9,12).
What are the key properties of 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide?
2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide has a molecular weight of 183.21 g/mol, XLogP of 0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)acetamide is sourced from PubChem (CID 118570581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).