C21H17ClN8O — CID 118571566
4-amino-6-[[(1S)-1-[3-(3-aminophenyl)-5-chloro-4-oxoquinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile (PubChem CID 118571566) has the molecular formula C21H17ClN8O and a molecular weight of 432.88 g/mol. Its IUPAC name is 4-amino-6-[[(1S)-1-[3-(3-aminophenyl)-5-chloro-4-oxoquinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-[[(1S)-1-[3-(3-aminophenyl)-5-chloro-4-oxoquinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 118571566 |
| Molecular Formula | C21H17ClN8O |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-amino-6-[[(1S)-1-[3-(3-aminophenyl)-5-chloro-4-oxoquinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile |
| SMILES | C[C@H](Nc1ncnc(N)c1C#N)c1nc2cccc(Cl)c2c(=O)n1-c1cccc(N)c1 |
| InChI | InChI=1S/C21H17ClN8O/c1-11(28-19-14(9-23)18(25)26-10-27-19)20-29-16-7-3-6-15(22)17(16)21(31)30(20)13-5-2-4-12(24)8-13/h2-8,10-11H,24H2,1H3,(H3,25,26,27,28)/t11-/m0/s1 |
| InChIKey | ZXHZFZFWBWCWFH-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 148.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|