C23H24ClFN4O3 — CID 118571802
tert-butyl (2S,4S)-2-[3-(3-aminophenyl)-5-chloro-4-oxoquinazolin-2-yl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 118571802) has the molecular formula C23H24ClFN4O3 and a molecular weight of 458.92 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[3-(3-aminophenyl)-5-chloro-4-oxoquinazolin-2-yl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[3-(3-aminophenyl)-5-chloro-4-oxoquinazolin-2-yl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118571802 |
| Molecular Formula | C23H24ClFN4O3 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | tert-butyl (2S,4S)-2-[3-(3-aminophenyl)-5-chloro-4-oxoquinazolin-2-yl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1c1nc2cccc(Cl)c2c(=O)n1-c1cccc(N)c1 |
| InChI | InChI=1S/C23H24ClFN4O3/c1-23(2,3)32-22(31)28-12-13(25)10-18(28)20-27-17-9-5-8-16(24)19(17)21(30)29(20)15-7-4-6-14(26)11-15/h4-9,11,13,18H,10,12,26H2,1-3H3/t13-,18-/m0/s1 |
| InChIKey | WONOVBCHRNOHHY-UGSOOPFHSA-N |
| XLogP | 4.64 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|