C31H22F5N5O7S2 — CID 118573562
[5-[6-(ethylsulfonylamino)-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]-3-(4-fluoro-1H-indol-2-yl)pyrazin-2-yl] trifluoromethanesulfonate (PubChem CID 118573562) has the molecular formula C31H22F5N5O7S2 and a molecular weight of 735.67 g/mol. Its IUPAC name is [5-[6-(ethylsulfonylamino)-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]-3-(4-fluoro-1H-indol-2-yl)pyrazin-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-[6-(ethylsulfonylamino)-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]-3-(4-fluoro-1H-indol-2-yl)pyrazin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118573562 |
| Molecular Formula | C31H22F5N5O7S2 |
| Molecular Weight | 735.67 g/mol |
| Exact Mass | 735.09 |
| IUPAC Name | [5-[6-(ethylsulfonylamino)-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]-3-(4-fluoro-1H-indol-2-yl)pyrazin-2-yl] trifluoromethanesulfonate |
| SMILES | CCS(=O)(=O)Nc1cc2oc(-c3ccc(F)cc3)c(C(=O)NC)c2cc1-c1cnc(OS(=O)(=O)C(F)(F)F)c(-c2cc3c(F)cccc3[nH]2)n1 |
| InChI | InChI=1S/C31H22F5N5O7S2/c1-3-49(43,44)41-22-13-25-19(26(29(42)37-2)28(47-25)15-7-9-16(32)10-8-15)11-18(22)24-14-38-30(48-50(45,46)31(34,35)36)27(40-24)23-12-17-20(33)5-4-6-21(17)39-23/h4-14,39,41H,3H2,1-2H3,(H,37,42) |
| InChIKey | BHZNZIAZAUROEY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|