C19H18ClN9O — CID 118573804
2,4-diamino-6-[1-[5-chloro-3-(3-cyanopropyl)-4-oxoquinazolin-2-yl]ethylamino]pyrimidine-5-carbonitrile (PubChem CID 118573804) has the molecular formula C19H18ClN9O and a molecular weight of 423.87 g/mol. Its IUPAC name is 2,4-diamino-6-[1-[5-chloro-3-(3-cyanopropyl)-4-oxoquinazolin-2-yl]ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[1-[5-chloro-3-(3-cyanopropyl)-4-oxoquinazolin-2-yl]ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 118573804 |
| Molecular Formula | C19H18ClN9O |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2,4-diamino-6-[1-[5-chloro-3-(3-cyanopropyl)-4-oxoquinazolin-2-yl]ethylamino]pyrimidine-5-carbonitrile |
| SMILES | CC(Nc1nc(N)nc(N)c1C#N)c1nc2cccc(Cl)c2c(=O)n1CCCC#N |
| InChI | InChI=1S/C19H18ClN9O/c1-10(25-16-11(9-22)15(23)27-19(24)28-16)17-26-13-6-4-5-12(20)14(13)18(30)29(17)8-3-2-7-21/h4-6,10H,2-3,8H2,1H3,(H5,23,24,25,27,28) |
| InChIKey | RJMIQSXARAWLNF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|