C4H7Br2NO — CID 118574416
N-(3,3-dibromopropyl)formamide (PubChem CID 118574416) has the molecular formula C4H7Br2NO and a molecular weight of 244.91 g/mol. Its IUPAC name is N-(3,3-dibromopropyl)formamide.
| Compound Name | N-(3,3-dibromopropyl)formamide |
|---|---|
| PubChem CID | 118574416 |
| Molecular Formula | C4H7Br2NO |
| Molecular Weight | 244.91 g/mol |
| Exact Mass | 242.89 |
| IUPAC Name | N-(3,3-dibromopropyl)formamide |
| SMILES | O=CNCCC(Br)Br |
| InChI | InChI=1S/C4H7Br2NO/c5-4(6)1-2-7-3-8/h3-4H,1-2H2,(H,7,8) |
| InChIKey | SPKDOFQKVCXBIR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.91 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|