C25H34O2 — CID 118574689
(3S,5R,8S,9S,10R,13R,14S,17R)-16-benzylidene-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 118574689) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is (3S,5R,8S,9S,10R,13R,14S,17R)-16-benzylidene-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3S,5R,8S,9S,10R,13R,14S,17R)-16-benzylidene-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 118574689 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (3S,5R,8S,9S,10R,13R,14S,17R)-16-benzylidene-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@@]12CC[C@H]3[C@@H]4CC[C@H](O)C[C@H]4CC[C@@H]3[C@@H]1CC(=Cc1ccccc1)[C@H]2O |
| InChI | InChI=1S/C25H34O2/c1-25-12-11-21-20-10-8-19(26)14-17(20)7-9-22(21)23(25)15-18(24(25)27)13-16-5-3-2-4-6-16/h2-6,13,17,19-24,26-27H,7-12,14-15H2,1H3/t17-,19+,20-,21+,22+,23+,24-,25-/m1/s1 |
| InChIKey | BAGZVXJDNIEHHR-ILWIEIKRSA-N |
| XLogP | 5.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |