C48H44N16 — CID 118574790
4-N,6-N-bis(4-aminophenyl)-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine;2-N,4-N-bis(3-aminophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 118574790) has the molecular formula C48H44N16 and a molecular weight of 844.99 g/mol. Its IUPAC name is 4-N,6-N-bis(4-aminophenyl)-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine;2-N,4-N-bis(3-aminophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(4-aminophenyl)-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine;2-N,4-N-bis(3-aminophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 118574790 |
| Molecular Formula | C48H44N16 |
| Molecular Weight | 844.99 g/mol |
| Exact Mass | 844.39 |
| IUPAC Name | 4-N,6-N-bis(4-aminophenyl)-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine;2-N,4-N-bis(3-aminophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1ccc(Nc2nc(Nc3ccc(N)cc3)nc(N(c3ccccc3)c3ccccc3)n2)cc1.Nc1cccc(Nc2nc(Nc3ccccc3)nc(Nc3cccc(N)c3)n2)c1 |
| InChI | InChI=1S/C27H24N8.C21H20N8/c28-19-11-15-21(16-12-19)30-25-32-26(31-22-17-13-20(29)14-18-22)34-27(33-25)35(23-7-3-1-4-8-23)24-9-5-2-6-10-24;22-14-6-4-10-17(12-14)25-20-27-19(24-16-8-2-1-3-9-16)28-21(29-20)26-18-11-5-7-15(23)13-18/h1-18H,28-29H2,(H2,30,31,32,33,34);1-13H,22-23H2,(H3,24,25,26,27,28,29) |
| InChIKey | UDWQTCMKFIKFSB-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 244.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.99 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|