C20H21N5O2 — CID 118575151
2-[(4-methoxy-N-methylanilino)methyl]-5-pyridin-2-yl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 118575151) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[(4-methoxy-N-methylanilino)methyl]-5-pyridin-2-yl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2-[(4-methoxy-N-methylanilino)methyl]-5-pyridin-2-yl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 118575151 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[(4-methoxy-N-methylanilino)methyl]-5-pyridin-2-yl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | COc1ccc(N(C)Cc2cc3n(n2)CCN(c2ccccn2)C3=O)cc1 |
| InChI | InChI=1S/C20H21N5O2/c1-23(16-6-8-17(27-2)9-7-16)14-15-13-18-20(26)24(11-12-25(18)22-15)19-5-3-4-10-21-19/h3-10,13H,11-12,14H2,1-2H3 |
| InChIKey | IWZJVOXGZYGQLH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|