C18H13Cl2F3N4O2S — CID 118576626
2-amino-4-(5,7-dichloro-2,3-dihydro-1-benzofuran-4-yl)-N-methyl-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 118576626) has the molecular formula C18H13Cl2F3N4O2S and a molecular weight of 477.30 g/mol. Its IUPAC name is 2-amino-4-(5,7-dichloro-2,3-dihydro-1-benzofuran-4-yl)-N-methyl-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-4-(5,7-dichloro-2,3-dihydro-1-benzofuran-4-yl)-N-methyl-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 118576626 |
| Molecular Formula | C18H13Cl2F3N4O2S |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 2-amino-4-(5,7-dichloro-2,3-dihydro-1-benzofuran-4-yl)-N-methyl-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1cc2c(-c3c(Cl)cc(Cl)c4c3CCO4)nc(N)nc2s1 |
| InChI | InChI=1S/C18H13Cl2F3N4O2S/c1-27(6-18(21,22)23)16(28)11-4-8-13(25-17(24)26-15(8)30-11)12-7-2-3-29-14(7)10(20)5-9(12)19/h4-5H,2-3,6H2,1H3,(H2,24,25,26) |
| InChIKey | FUKAXMLMSNSPPF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |