C22H22N4O — CID 118577272
7-amino-2-[3-(2,6-dimethyl-4-pyridinyl)phenyl]-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (PubChem CID 118577272) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 7-amino-2-[3-(2,6-dimethyl-4-pyridinyl)phenyl]-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one.
| Compound Name | 7-amino-2-[3-(2,6-dimethyl-4-pyridinyl)phenyl]-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 118577272 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 7-amino-2-[3-(2,6-dimethyl-4-pyridinyl)phenyl]-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| SMILES | Cc1cc(-c2cccc(C3CC(=O)Nc4cc(N)ccc4N3)c2)cc(C)n1 |
| InChI | InChI=1S/C22H22N4O/c1-13-8-17(9-14(2)24-13)15-4-3-5-16(10-15)20-12-22(27)26-21-11-18(23)6-7-19(21)25-20/h3-11,20,25H,12,23H2,1-2H3,(H,26,27) |
| InChIKey | QGOQPUDKPOMWEA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|