About (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate
(6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 11857752) has the molecular formula C14H12ClF3N2O3
and a molecular weight of 348.71 g/mol. Its IUPAC name is (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate |
| PubChem CID | 11857752 |
| Molecular Formula | C14H12ClF3N2O3 |
| Molecular Weight | 348.71 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | O=C(Oc1noc2cc(Cl)ccc12)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H12ClF3N2O3/c15-9-1-2-10-11(7-9)23-19-12(10)22-13(21)20-5-3-8(4-6-20)14(16,17)18/h1-2,7-8H,3-6H2 |
| InChIKey | WIWFHDJSYIPMFX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate?
The IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate (CID 11857752) is (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate.
What is the SMILES notation for (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate?
The canonical SMILES for (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate is O=C(Oc1noc2cc(Cl)ccc12)N1CCC(C(F)(F)F)CC1.
What is the InChIKey of (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate?
The InChIKey is WIWFHDJSYIPMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClF3N2O3/c15-9-1-2-10-11(7-9)23-19-12(10)22-13(21)20-5-3-8(4-6-20)14(16,17)18/h1-2,7-8H,3-6H2.
What are the key properties of (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate?
(6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate has a molecular weight of 348.71 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,2-benzoxazol-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate is sourced from PubChem (CID 11857752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).