C22H24F3N9 — CID 118578642
9-ethyl-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-8-[6-(trifluoromethyl)-3-pyridinyl]purin-6-amine (PubChem CID 118578642) has the molecular formula C22H24F3N9 and a molecular weight of 471.49 g/mol. Its IUPAC name is 9-ethyl-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-8-[6-(trifluoromethyl)-3-pyridinyl]purin-6-amine.
| Compound Name | 9-ethyl-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-8-[6-(trifluoromethyl)-3-pyridinyl]purin-6-amine |
|---|---|
| PubChem CID | 118578642 |
| Molecular Formula | C22H24F3N9 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 9-ethyl-N-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-8-[6-(trifluoromethyl)-3-pyridinyl]purin-6-amine |
| SMILES | CCn1c(-c2ccc(C(F)(F)F)nc2)nc2c(NC3CCc4nnc(C(C)C)n4C3)ncnc21 |
| InChI | InChI=1S/C22H24F3N9/c1-4-33-20(13-5-7-15(26-9-13)22(23,24)25)30-17-18(27-11-28-21(17)33)29-14-6-8-16-31-32-19(12(2)3)34(16)10-14/h5,7,9,11-12,14H,4,6,8,10H2,1-3H3,(H,27,28,29) |
| InChIKey | JSEBJSXSWSGRJV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |