About 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one
2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one (PubChem CID 11857874) has the molecular formula C28H22FN3O4
and a molecular weight of 483.50 g/mol. Its IUPAC name is 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one |
| PubChem CID | 11857874 |
| Molecular Formula | C28H22FN3O4 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one |
| SMILES | COc1cc2nccc(Oc3ccc(-c4cnc(Cc5ccccc5)[nH]c4=O)cc3F)c2cc1OC |
| InChI | InChI=1S/C28H22FN3O4/c1-34-25-14-19-22(15-26(25)35-2)30-11-10-23(19)36-24-9-8-18(13-21(24)29)20-16-31-27(32-28(20)33)12-17-6-4-3-5-7-17/h3-11,13-16H,12H2,1-2H3,(H,31,32,33) |
| InChIKey | VFNQFMVWZBQRKK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one?
The IUPAC name of 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one (CID 11857874) is 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one.
What is the SMILES notation for 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one?
The canonical SMILES for 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one is COc1cc2nccc(Oc3ccc(-c4cnc(Cc5ccccc5)[nH]c4=O)cc3F)c2cc1OC.
What is the InChIKey of 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one?
The InChIKey is VFNQFMVWZBQRKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22FN3O4/c1-34-25-14-19-22(15-26(25)35-2)30-11-10-23(19)36-24-9-8-18(13-21(24)29)20-16-31-27(32-28(20)33)12-17-6-4-3-5-7-17/h3-11,13-16H,12H2,1-2H3,(H,31,32,33).
What are the key properties of 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one?
2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one has a molecular weight of 483.50 g/mol, XLogP of 5.52, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1H-pyrimidin-6-one is sourced from PubChem (CID 11857874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).