About (1R)-1-chloropropane-1,3-diol
(1R)-1-chloropropane-1,3-diol (PubChem CID 118578873) has the molecular formula C3H7ClO2
and a molecular weight of 110.54 g/mol. Its IUPAC name is (1R)-1-chloropropane-1,3-diol.
Molecular Properties
| Compound Name | (1R)-1-chloropropane-1,3-diol |
| PubChem CID | 118578873 |
| Molecular Formula | C3H7ClO2 |
| Molecular Weight | 110.54 g/mol |
| Exact Mass | 110.01 |
| IUPAC Name | (1R)-1-chloropropane-1,3-diol |
| SMILES | OCC[C@H](O)Cl |
| InChI | InChI=1S/C3H7ClO2/c4-3(6)1-2-5/h3,5-6H,1-2H2/t3-/m0/s1 |
| InChIKey | PSYQXTDKRKLJQC-VKHMYHEASA-N |
| XLogP | -0.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.54 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-chloropropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-chloropropane-1,3-diol?
The IUPAC name of (1R)-1-chloropropane-1,3-diol (CID 118578873) is (1R)-1-chloropropane-1,3-diol.
What is the SMILES notation for (1R)-1-chloropropane-1,3-diol?
The canonical SMILES for (1R)-1-chloropropane-1,3-diol is OCC[C@H](O)Cl.
What is the InChIKey of (1R)-1-chloropropane-1,3-diol?
The InChIKey is PSYQXTDKRKLJQC-VKHMYHEASA-N. The full InChI is InChI=1S/C3H7ClO2/c4-3(6)1-2-5/h3,5-6H,1-2H2/t3-/m0/s1.
What are the key properties of (1R)-1-chloropropane-1,3-diol?
(1R)-1-chloropropane-1,3-diol has a molecular weight of 110.54 g/mol, XLogP of -0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-chloropropane-1,3-diol is sourced from PubChem (CID 118578873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).