C28H26F3N7O3 — CID 118579008
N-[[4-[4-amino-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]-3-(trifluoromethoxy)benzamide (PubChem CID 118579008) has the molecular formula C28H26F3N7O3 and a molecular weight of 565.56 g/mol. Its IUPAC name is N-[[4-[4-amino-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]-3-(trifluoromethoxy)benzamide.
| Compound Name | N-[[4-[4-amino-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 118579008 |
| Molecular Formula | C28H26F3N7O3 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | N-[[4-[4-amino-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]-3-(trifluoromethoxy)benzamide |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(CNC(=O)c4cccc(OC(F)(F)F)c4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C28H26F3N7O3/c1-2-22(39)37-12-4-6-20(15-37)38-26-23(25(32)34-16-35-26)24(36-38)18-10-8-17(9-11-18)14-33-27(40)19-5-3-7-21(13-19)41-28(29,30)31/h2-3,5,7-11,13,16,20H,1,4,6,12,14-15H2,(H,33,40)(H2,32,34,35)/t20-/m1/s1 |
| InChIKey | ZTEOXMDYGUMLIO-HXUWFJFHSA-N |
| XLogP | 4.25 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|