C19H24O4 — CID 118579642
(1R,9S)-1-[(1E)-2,6-dimethyl-5-oxohepta-1,6-dienyl]-9-methyl-2-oxaspiro[4.5]dec-7-ene-3,6-dione (PubChem CID 118579642) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (1R,9S)-1-[(1E)-2,6-dimethyl-5-oxohepta-1,6-dienyl]-9-methyl-2-oxaspiro[4.5]dec-7-ene-3,6-dione.
| Compound Name | (1R,9S)-1-[(1E)-2,6-dimethyl-5-oxohepta-1,6-dienyl]-9-methyl-2-oxaspiro[4.5]dec-7-ene-3,6-dione |
|---|---|
| PubChem CID | 118579642 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1R,9S)-1-[(1E)-2,6-dimethyl-5-oxohepta-1,6-dienyl]-9-methyl-2-oxaspiro[4.5]dec-7-ene-3,6-dione |
| SMILES | C=C(C)C(=O)CC/C(C)=C/[C@H]1OC(=O)CC12C[C@H](C)C=CC2=O |
| InChI | InChI=1S/C19H24O4/c1-12(2)15(20)7-5-13(3)9-17-19(11-18(22)23-17)10-14(4)6-8-16(19)21/h6,8-9,14,17H,1,5,7,10-11H2,2-4H3/b13-9+/t14-,17-,19?/m1/s1 |
| InChIKey | LJCSAWRVSSZSEV-MOMKSSJJSA-N |
| XLogP | 3.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|