C20H19ClFNO3 — CID 118580170
(3R)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-1-(4-methylphenyl)pyrrolidin-2-one (PubChem CID 118580170) has the molecular formula C20H19ClFNO3 and a molecular weight of 375.83 g/mol. Its IUPAC name is (3R)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-1-(4-methylphenyl)pyrrolidin-2-one.
| Compound Name | (3R)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-1-(4-methylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 118580170 |
| Molecular Formula | C20H19ClFNO3 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (3R)-3-[3-(3-chloro-5-fluorophenyl)propanoyl]-3-hydroxy-1-(4-methylphenyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(N2CC[C@@](O)(C(=O)CCc3cc(F)cc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C20H19ClFNO3/c1-13-2-5-17(6-3-13)23-9-8-20(26,19(23)25)18(24)7-4-14-10-15(21)12-16(22)11-14/h2-3,5-6,10-12,26H,4,7-9H2,1H3/t20-/m1/s1 |
| InChIKey | YFIIDFOLXBIRST-HXUWFJFHSA-N |
| XLogP | 3.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|