C21H33BrO3 — CID 118580428
(3R,5R,8S,9R,10R,13R,14R,16S)-16-bromo-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol (PubChem CID 118580428) has the molecular formula C21H33BrO3 and a molecular weight of 413.40 g/mol. Its IUPAC name is (3R,5R,8S,9R,10R,13R,14R,16S)-16-bromo-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol.
| Compound Name | (3R,5R,8S,9R,10R,13R,14R,16S)-16-bromo-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol |
|---|---|
| PubChem CID | 118580428 |
| Molecular Formula | C21H33BrO3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (3R,5R,8S,9R,10R,13R,14R,16S)-16-bromo-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol |
| SMILES | C[C@@]12CC[C@@H](O)C[C@H]1CC[C@H]1[C@H]2CC[C@]2(C)[C@@H]1C[C@H](Br)C21OCCO1 |
| InChI | InChI=1S/C21H33BrO3/c1-19-7-5-14(23)11-13(19)3-4-15-16(19)6-8-20(2)17(15)12-18(22)21(20)24-9-10-25-21/h13-18,23H,3-12H2,1-2H3/t13-,14-,15+,16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | HQBOTKQFNUEUFZ-WHLNWLGISA-N |
| XLogP | 4.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|