C10H5N3O3 — CID 118581067
1,3-diethynyl-5-prop-2-ynyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 118581067) has the molecular formula C10H5N3O3 and a molecular weight of 215.17 g/mol. Its IUPAC name is 1,3-diethynyl-5-prop-2-ynyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-diethynyl-5-prop-2-ynyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118581067 |
| Molecular Formula | C10H5N3O3 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 1,3-diethynyl-5-prop-2-ynyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C#CCn1c(=O)n(C#C)c(=O)n(C#C)c1=O |
| InChI | InChI=1S/C10H5N3O3/c1-4-7-13-9(15)11(5-2)8(14)12(6-3)10(13)16/h1-3H,7H2 |
| InChIKey | SXAPIGVLFBDJEE-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|