C25H23N3O7 — CID 118581551
2-[[(3S,3aS)-7-[(4R)-4-(hydroxymethyl)-2-oxopiperidin-1-yl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 118581551) has the molecular formula C25H23N3O7 and a molecular weight of 477.47 g/mol. Its IUPAC name is 2-[[(3S,3aS)-7-[(4R)-4-(hydroxymethyl)-2-oxopiperidin-1-yl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(3S,3aS)-7-[(4R)-4-(hydroxymethyl)-2-oxopiperidin-1-yl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118581551 |
| Molecular Formula | C25H23N3O7 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[[(3S,3aS)-7-[(4R)-4-(hydroxymethyl)-2-oxopiperidin-1-yl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@@H]1OC(=O)N2c3ccc(N4CC[C@@H](CO)CC4=O)cc3OC[C@@H]12 |
| InChI | InChI=1S/C25H23N3O7/c29-12-14-7-8-26(22(30)9-14)15-5-6-18-20(10-15)34-13-19-21(35-25(33)28(18)19)11-27-23(31)16-3-1-2-4-17(16)24(27)32/h1-6,10,14,19,21,29H,7-9,11-13H2/t14-,19+,21+/m1/s1 |
| InChIKey | PHZMPOZSAQYHKN-RFVSGWPVSA-N |
| XLogP | 1.80 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|