About 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline
6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline (PubChem CID 11858198) has the molecular formula C25H17F6NO
and a molecular weight of 461.41 g/mol. Its IUPAC name is 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline.
Molecular Properties
| Compound Name | 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline |
| PubChem CID | 11858198 |
| Molecular Formula | C25H17F6NO |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline |
| SMILES | Cc1ccccc1-c1c(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc2ncccc12 |
| InChI | InChI=1S/C25H17F6NO/c1-15-5-2-3-6-19(15)23-20-7-4-10-32-21(20)8-9-22(23)33-14-16-11-17(24(26,27)28)13-18(12-16)25(29,30)31/h2-13H,14H2,1H3 |
| InChIKey | QLUQVVIXHOYZOL-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline?
The IUPAC name of 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline (CID 11858198) is 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline.
What is the SMILES notation for 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline?
The canonical SMILES for 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline is Cc1ccccc1-c1c(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc2ncccc12.
What is the InChIKey of 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline?
The InChIKey is QLUQVVIXHOYZOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17F6NO/c1-15-5-2-3-6-19(15)23-20-7-4-10-32-21(20)8-9-22(23)33-14-16-11-17(24(26,27)28)13-18(12-16)25(29,30)31/h2-13H,14H2,1H3.
What are the key properties of 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline?
6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline has a molecular weight of 461.41 g/mol, XLogP of 7.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(2-methylphenyl)quinoline is sourced from PubChem (CID 11858198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).