C14H23N — CID 118582192
4-propan-2-yl-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine (PubChem CID 118582192) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 4-propan-2-yl-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine.
| Compound Name | 4-propan-2-yl-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
|---|---|
| PubChem CID | 118582192 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 4-propan-2-yl-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
| SMILES | CC(C)C1=C2CCCCCCC2C=NC1 |
| InChI | InChI=1S/C14H23N/c1-11(2)14-10-15-9-12-7-5-3-4-6-8-13(12)14/h9,11-12H,3-8,10H2,1-2H3 |
| InChIKey | PUPSZFVZHXEROZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|