C24H30Cl2N2O5S — CID 118582310
1-[2-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-5,8-dichloro-1-oxo-3,4-dihydroisoquinolin-7-yl]ethyl methanesulfonate (PubChem CID 118582310) has the molecular formula C24H30Cl2N2O5S and a molecular weight of 529.49 g/mol. Its IUPAC name is 1-[2-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-5,8-dichloro-1-oxo-3,4-dihydroisoquinolin-7-yl]ethyl methanesulfonate.
| Compound Name | 1-[2-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-5,8-dichloro-1-oxo-3,4-dihydroisoquinolin-7-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 118582310 |
| Molecular Formula | C24H30Cl2N2O5S |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 1-[2-[(2-butoxy-4,6-dimethyl-3-pyridinyl)methyl]-5,8-dichloro-1-oxo-3,4-dihydroisoquinolin-7-yl]ethyl methanesulfonate |
| SMILES | CCCCOc1nc(C)cc(C)c1CN1CCc2c(Cl)cc(C(C)OS(C)(=O)=O)c(Cl)c2C1=O |
| InChI | InChI=1S/C24H30Cl2N2O5S/c1-6-7-10-32-23-19(14(2)11-15(3)27-23)13-28-9-8-17-20(25)12-18(16(4)33-34(5,30)31)22(26)21(17)24(28)29/h11-12,16H,6-10,13H2,1-5H3 |
| InChIKey | ZPQZRWVAOOBMBB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|