C8H7N3OS — CID 11858267
5-(3-hydroxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 11858267) has the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. Its IUPAC name is 5-(3-hydroxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(3-hydroxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 11858267 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 5-(3-hydroxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Oc1cccc(-c2nc(=S)[nH][nH]2)c1 |
| InChI | InChI=1S/C8H7N3OS/c12-6-3-1-2-5(4-6)7-9-8(13)11-10-7/h1-4,12H,(H2,9,10,11,13) |
| InChIKey | CABBNARYGIEYFL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|