C26H36N4O6 — CID 118583234
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylpentanamide (PubChem CID 118583234) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylpentanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 118583234 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylpentanamide |
| SMILES | COc1ccc(CNC(=O)[C@@H](CC(C)C)/N=C(\N)NC(=O)Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H36N4O6/c1-16(2)11-19(25(32)28-15-18-8-10-21(34-4)23(13-18)36-6)29-26(27)30-24(31)14-17-7-9-20(33-3)22(12-17)35-5/h7-10,12-13,16,19H,11,14-15H2,1-6H3,(H,28,32)(H3,27,29,30,31)/t19-/m1/s1 |
| InChIKey | ZPJPITDEBBRIJP-LJQANCHMSA-N |
| XLogP | 2.43 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|