About 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine
2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 118583246) has the molecular formula C20H37N
and a molecular weight of 291.52 g/mol. Its IUPAC name is 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 118583246 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCC(CCC)C1=CC=CC(C(CCC)CCC)C1N |
| InChI | InChI=1S/C20H37N/c1-5-10-16(11-6-2)18-14-9-15-19(20(18)21)17(12-7-3)13-8-4/h9,14-18,20H,5-8,10-13,21H2,1-4H3 |
| InChIKey | IKDXGNHYONWMOI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine (CID 118583246) is 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine is CCCC(CCC)C1=CC=CC(C(CCC)CCC)C1N.
What is the InChIKey of 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine?
The InChIKey is IKDXGNHYONWMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37N/c1-5-10-16(11-6-2)18-14-9-15-19(20(18)21)17(12-7-3)13-8-4/h9,14-18,20H,5-8,10-13,21H2,1-4H3.
What are the key properties of 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine?
2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine has a molecular weight of 291.52 g/mol, XLogP of 5.86, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(heptan-4-yl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 118583246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).