C26H28F4O — CID 118583503
3-propyl-6-(1,8,9,9-tetrafluoro-7-pentylfluoren-2-yl)-3,4-dihydro-2H-pyran (PubChem CID 118583503) has the molecular formula C26H28F4O and a molecular weight of 432.50 g/mol. Its IUPAC name is 3-propyl-6-(1,8,9,9-tetrafluoro-7-pentylfluoren-2-yl)-3,4-dihydro-2H-pyran.
| Compound Name | 3-propyl-6-(1,8,9,9-tetrafluoro-7-pentylfluoren-2-yl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583503 |
| Molecular Formula | C26H28F4O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 3-propyl-6-(1,8,9,9-tetrafluoro-7-pentylfluoren-2-yl)-3,4-dihydro-2H-pyran |
| SMILES | CCCCCc1ccc2c(c1F)C(F)(F)c1c-2ccc(C2=CCC(CCC)CO2)c1F |
| InChI | InChI=1S/C26H28F4O/c1-3-5-6-8-17-10-11-18-19-12-13-20(21-14-9-16(7-4-2)15-31-21)25(28)23(19)26(29,30)22(18)24(17)27/h10-14,16H,3-9,15H2,1-2H3 |
| InChIKey | HNRAIEIUAGCQOD-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|