C16H24N2O — CID 118584139
(1R,9R,10S)-17-methyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),5-dien-4-ol (PubChem CID 118584139) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R,9R,10S)-17-methyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),5-dien-4-ol.
| Compound Name | (1R,9R,10S)-17-methyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),5-dien-4-ol |
|---|---|
| PubChem CID | 118584139 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (1R,9R,10S)-17-methyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),5-dien-4-ol |
| SMILES | CN1CC[C@]23CCNC[C@H]2[C@H]1CC1=C3CC(O)C=C1 |
| InChI | InChI=1S/C16H24N2O/c1-18-7-5-16-4-6-17-10-14(16)15(18)8-11-2-3-12(19)9-13(11)16/h2-3,12,14-15,17,19H,4-10H2,1H3/t12?,14-,15+,16-/m0/s1 |
| InChIKey | BVRQLWFVTRKXAP-WDVRLDOZSA-N |
| XLogP | 1.31 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |