C15H20O5 — CID 118584224
[(3R,4R)-4-hydroxyoxan-3-yl] 3-(2-methoxyphenyl)propanoate (PubChem CID 118584224) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(3R,4R)-4-hydroxyoxan-3-yl] 3-(2-methoxyphenyl)propanoate.
| Compound Name | [(3R,4R)-4-hydroxyoxan-3-yl] 3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 118584224 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [(3R,4R)-4-hydroxyoxan-3-yl] 3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CCC(=O)O[C@@H]1COCC[C@H]1O |
| InChI | InChI=1S/C15H20O5/c1-18-13-5-3-2-4-11(13)6-7-15(17)20-14-10-19-9-8-12(14)16/h2-5,12,14,16H,6-10H2,1H3/t12-,14-/m1/s1 |
| InChIKey | ZOVROHXTLYLSOJ-TZMCWYRMSA-N |
| XLogP | 1.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |