C44H58O2Si2 — CID 11858510
tert-butyl-[(4E,8E)-12-[tert-butyl(diphenyl)silyl]oxydodeca-4,8-dienoxy]-diphenylsilane (PubChem CID 11858510) has the molecular formula C44H58O2Si2 and a molecular weight of 675.12 g/mol. Its IUPAC name is tert-butyl-[(4E,8E)-12-[tert-butyl(diphenyl)silyl]oxydodeca-4,8-dienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4E,8E)-12-[tert-butyl(diphenyl)silyl]oxydodeca-4,8-dienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11858510 |
| Molecular Formula | C44H58O2Si2 |
| Molecular Weight | 675.12 g/mol |
| Exact Mass | 674.40 |
| IUPAC Name | tert-butyl-[(4E,8E)-12-[tert-butyl(diphenyl)silyl]oxydodeca-4,8-dienoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCC/C=C/CC/C=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H58O2Si2/c1-43(2,3)47(39-29-19-15-20-30-39,40-31-21-16-22-32-40)45-37-27-13-11-9-7-8-10-12-14-28-38-46-48(44(4,5)6,41-33-23-17-24-34-41)42-35-25-18-26-36-42/h9-12,15-26,29-36H,7-8,13-14,27-28,37-38H2,1-6H3/b11-9+,12-10+ |
| InChIKey | LUQKJNMNMPJSGA-WGDLNXRISA-N |
| XLogP | 9.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.12 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|