C44H60O5Si2 — CID 11858511
(1R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,5S)-5-[(1S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxybutyl]oxolan-2-yl]butan-1-ol (PubChem CID 11858511) has the molecular formula C44H60O5Si2 and a molecular weight of 725.13 g/mol. Its IUPAC name is (1R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,5S)-5-[(1S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxybutyl]oxolan-2-yl]butan-1-ol.
| Compound Name | (1R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,5S)-5-[(1S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxybutyl]oxolan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 11858511 |
| Molecular Formula | C44H60O5Si2 |
| Molecular Weight | 725.13 g/mol |
| Exact Mass | 724.40 |
| IUPAC Name | (1R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,5S)-5-[(1S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxybutyl]oxolan-2-yl]butan-1-ol |
| SMILES | CC(C)(C)[Si](OCCC[C@@H](O)[C@H]1CC[C@@H]([C@@H](O)CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H60O5Si2/c1-43(2,3)50(35-21-11-7-12-22-35,36-23-13-8-14-24-36)47-33-19-29-39(45)41-31-32-42(49-41)40(46)30-20-34-48-51(44(4,5)6,37-25-15-9-16-26-37)38-27-17-10-18-28-38/h7-18,21-28,39-42,45-46H,19-20,29-34H2,1-6H3/t39-,40+,41-,42+ |
| InChIKey | ANWQIBGEOJZKFH-LDCYWHLHSA-N |
| XLogP | 6.97 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.13 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|