About [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate
[(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate (PubChem CID 11858516) has the molecular formula C19H16F3NO6S
and a molecular weight of 443.40 g/mol. Its IUPAC name is [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate |
| PubChem CID | 11858516 |
| Molecular Formula | C19H16F3NO6S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate |
| SMILES | C/C(OS(=O)(=O)C(F)(F)F)=C1/C[C@@H](c2ccccc2)O[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16F3NO6S/c1-12(29-30(26,27)19(20,21)22)16-11-17(13-5-3-2-4-6-13)28-18(16)14-7-9-15(10-8-14)23(24)25/h2-10,17-18H,11H2,1H3/b16-12+/t17-,18-/m0/s1 |
| InChIKey | MJDYVDDUYVINPH-VMPFUQBJSA-N |
| XLogP | 4.94 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate?
The IUPAC name of [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate (CID 11858516) is [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate.
What is the SMILES notation for [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate?
The canonical SMILES for [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate is C/C(OS(=O)(=O)C(F)(F)F)=C1/C[C@@H](c2ccccc2)O[C@H]1c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate?
The InChIKey is MJDYVDDUYVINPH-VMPFUQBJSA-N. The full InChI is InChI=1S/C19H16F3NO6S/c1-12(29-30(26,27)19(20,21)22)16-11-17(13-5-3-2-4-6-13)28-18(16)14-7-9-15(10-8-14)23(24)25/h2-10,17-18H,11H2,1H3/b16-12+/t17-,18-/m0/s1.
What are the key properties of [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate?
[(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate has a molecular weight of 443.40 g/mol, XLogP of 4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-1-[(2S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-ylidene]ethyl] trifluoromethanesulfonate is sourced from PubChem (CID 11858516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).