About N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine
N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 118585204) has the molecular formula C15H32N2S
and a molecular weight of 272.50 g/mol. Its IUPAC name is N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 118585204 |
| Molecular Formula | C15H32N2S |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CSCCNCCN(CC1CCCCC1)C(C)C |
| InChI | InChI=1S/C15H32N2S/c1-14(2)17(11-9-16-10-12-18-3)13-15-7-5-4-6-8-15/h14-16H,4-13H2,1-3H3 |
| InChIKey | GPBWAJVTYIUTHH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine (CID 118585204) is N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine is CSCCNCCN(CC1CCCCC1)C(C)C.
What is the InChIKey of N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is GPBWAJVTYIUTHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2S/c1-14(2)17(11-9-16-10-12-18-3)13-15-7-5-4-6-8-15/h14-16H,4-13H2,1-3H3.
What are the key properties of N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine?
N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 272.50 g/mol, XLogP of 3.23, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(cyclohexylmethyl)-N-(2-methylsulfanylethyl)-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 118585204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).