C18H26N4O4 — CID 118585548
N-[[3-[(morpholine-4-carbonylamino)methyl]phenyl]methyl]morpholine-4-carboxamide (PubChem CID 118585548) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[[3-[(morpholine-4-carbonylamino)methyl]phenyl]methyl]morpholine-4-carboxamide.
| Compound Name | N-[[3-[(morpholine-4-carbonylamino)methyl]phenyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 118585548 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-[[3-[(morpholine-4-carbonylamino)methyl]phenyl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NCc1cccc(CNC(=O)N2CCOCC2)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H26N4O4/c23-17(21-4-8-25-9-5-21)19-13-15-2-1-3-16(12-15)14-20-18(24)22-6-10-26-11-7-22/h1-3,12H,4-11,13-14H2,(H,19,23)(H,20,24) |
| InChIKey | WCKBFABZYYNPCO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |