About 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene
1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene (PubChem CID 118585581) has the molecular formula C19H20BrFO
and a molecular weight of 363.27 g/mol. Its IUPAC name is 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene.
Molecular Properties
| Compound Name | 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene |
| PubChem CID | 118585581 |
| Molecular Formula | C19H20BrFO |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene |
| SMILES | Cc1cc(F)ccc1OC[C@H]1[C@H](c2ccc(Br)cc2)C1(C)C |
| InChI | InChI=1S/C19H20BrFO/c1-12-10-15(21)8-9-17(12)22-11-16-18(19(16,2)3)13-4-6-14(20)7-5-13/h4-10,16,18H,11H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | IFDBEXHRFKTMBJ-WMZOPIPTSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene?
The IUPAC name of 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene (CID 118585581) is 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene.
What is the SMILES notation for 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene?
The canonical SMILES for 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene is Cc1cc(F)ccc1OC[C@H]1[C@H](c2ccc(Br)cc2)C1(C)C.
What is the InChIKey of 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene?
The InChIKey is IFDBEXHRFKTMBJ-WMZOPIPTSA-N. The full InChI is InChI=1S/C19H20BrFO/c1-12-10-15(21)8-9-17(12)22-11-16-18(19(16,2)3)13-4-6-14(20)7-5-13/h4-10,16,18H,11H2,1-3H3/t16-,18-/m0/s1.
What are the key properties of 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene?
1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene has a molecular weight of 363.27 g/mol, XLogP of 5.72, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1S,3S)-3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methoxy]-4-fluoro-2-methylbenzene is sourced from PubChem (CID 118585581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).