C24H44O7 — CID 118585608
1,2-bis[(2S,3R,4S,5R,6S)-4-ethyl-5,6-dimethoxy-3,5-dimethyloxan-2-yl]ethanone (PubChem CID 118585608) has the molecular formula C24H44O7 and a molecular weight of 444.61 g/mol. Its IUPAC name is 1,2-bis[(2S,3R,4S,5R,6S)-4-ethyl-5,6-dimethoxy-3,5-dimethyloxan-2-yl]ethanone.
| Compound Name | 1,2-bis[(2S,3R,4S,5R,6S)-4-ethyl-5,6-dimethoxy-3,5-dimethyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 118585608 |
| Molecular Formula | C24H44O7 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 1,2-bis[(2S,3R,4S,5R,6S)-4-ethyl-5,6-dimethoxy-3,5-dimethyloxan-2-yl]ethanone |
| SMILES | CC[C@H]1[C@@H](C)[C@@H](C(=O)C[C@H]2O[C@H](OC)[C@](C)(OC)[C@@H](CC)[C@H]2C)O[C@H](OC)[C@]1(C)OC |
| InChI | InChI=1S/C24H44O7/c1-11-16-14(3)19(30-21(26-7)23(16,5)28-9)13-18(25)20-15(4)17(12-2)24(6,29-10)22(27-8)31-20/h14-17,19-22H,11-13H2,1-10H3/t14-,15-,16+,17+,19-,20+,21+,22+,23-,24-/m1/s1 |
| InChIKey | MLVBAZSZRRAPJT-WTCWODEBSA-N |
| XLogP | 3.82 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |