C26H28Cl3NO8 — CID 11858569
[(2R,3S,4S,5R)-3-acetyloxy-4,5-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 11858569) has the molecular formula C26H28Cl3NO8 and a molecular weight of 588.87 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3-acetyloxy-4,5-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-3-acetyloxy-4,5-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11858569 |
| Molecular Formula | C26H28Cl3NO8 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | [(2R,3S,4S,5R)-3-acetyloxy-4,5-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H28Cl3NO8/c1-16(31)33-15-20-21(36-17(2)32)22(34-13-18-9-5-3-6-10-18)23(35-14-19-11-7-4-8-12-19)24(37-20)38-25(30)26(27,28)29/h3-12,20-24,30H,13-15H2,1-2H3/b30-25+/t20-,21+,22+,23-,24?/m1/s1 |
| InChIKey | HVEFDVJOSRUYPU-MRGKFXHHSA-N |
| XLogP | 4.74 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|