About 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol
3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol (PubChem CID 118585705) has the molecular formula C16H11N3O
and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol.
Molecular Properties
| Compound Name | 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol |
| PubChem CID | 118585705 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol |
| SMILES | Oc1cccc2cnc(-n3ccc4ccncc43)cc12 |
| InChI | InChI=1S/C16H11N3O/c20-15-3-1-2-12-9-18-16(8-13(12)15)19-7-5-11-4-6-17-10-14(11)19/h1-10,20H |
| InChIKey | HHXCJPQGEFSYTD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol?
The IUPAC name of 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol (CID 118585705) is 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol.
What is the SMILES notation for 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol?
The canonical SMILES for 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol is Oc1cccc2cnc(-n3ccc4ccncc43)cc12.
What is the InChIKey of 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol?
The InChIKey is HHXCJPQGEFSYTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O/c20-15-3-1-2-12-9-18-16(8-13(12)15)19-7-5-11-4-6-17-10-14(11)19/h1-10,20H.
What are the key properties of 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol?
3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol has a molecular weight of 261.28 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolo[2,3-c]pyridin-1-ylisoquinolin-5-ol is sourced from PubChem (CID 118585705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).