About methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate
methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate (PubChem CID 118585728) has the molecular formula C14H14N2O4
and a molecular weight of 274.28 g/mol. Its IUPAC name is methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate |
| PubChem CID | 118585728 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)C1=CCC=C2C=CC=CN2C1=O |
| InChI | InChI=1S/C14H14N2O4/c1-20-12(17)9-15-13(18)11-7-4-6-10-5-2-3-8-16(10)14(11)19/h2-3,5-8H,4,9H2,1H3,(H,15,18) |
| InChIKey | RAFQANCFNBHPRU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate?
The IUPAC name of methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate (CID 118585728) is methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate.
What is the SMILES notation for methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate?
The canonical SMILES for methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate is COC(=O)CNC(=O)C1=CCC=C2C=CC=CN2C1=O.
What is the InChIKey of methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate?
The InChIKey is RAFQANCFNBHPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O4/c1-20-12(17)9-15-13(18)11-7-4-6-10-5-2-3-8-16(10)14(11)19/h2-3,5-8H,4,9H2,1H3,(H,15,18).
What are the key properties of methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate?
methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate has a molecular weight of 274.28 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(6-oxo-9H-pyrido[1,2-a]azepine-7-carbonyl)amino]acetate is sourced from PubChem (CID 118585728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).