C14H15NO2 — CID 118585899
(1R,5S)-3-(3,5-dimethylphenyl)-1-methyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 118585899) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (1R,5S)-3-(3,5-dimethylphenyl)-1-methyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | (1R,5S)-3-(3,5-dimethylphenyl)-1-methyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 118585899 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (1R,5S)-3-(3,5-dimethylphenyl)-1-methyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)[C@H]3C[C@@]3(C)C2=O)c1 |
| InChI | InChI=1S/C14H15NO2/c1-8-4-9(2)6-10(5-8)15-12(16)11-7-14(11,3)13(15)17/h4-6,11H,7H2,1-3H3/t11-,14-/m1/s1 |
| InChIKey | RWLRHGQIQDVQHY-BXUZGUMPSA-N |
| XLogP | 2.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|