About pyridin-2-yl 4-methylbenzenesulfonate
pyridin-2-yl 4-methylbenzenesulfonate (PubChem CID 11858611) has the molecular formula C12H11NO3S
and a molecular weight of 249.29 g/mol. Its IUPAC name is pyridin-2-yl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | pyridin-2-yl 4-methylbenzenesulfonate |
| PubChem CID | 11858611 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | pyridin-2-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccn2)cc1 |
| InChI | InChI=1S/C12H11NO3S/c1-10-5-7-11(8-6-10)17(14,15)16-12-4-2-3-9-13-12/h2-9H,1H3 |
| InChIKey | YXCSPMRGMHOTBN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-yl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl 4-methylbenzenesulfonate?
The IUPAC name of pyridin-2-yl 4-methylbenzenesulfonate (CID 11858611) is pyridin-2-yl 4-methylbenzenesulfonate.
What is the SMILES notation for pyridin-2-yl 4-methylbenzenesulfonate?
The canonical SMILES for pyridin-2-yl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)Oc2ccccn2)cc1.
What is the InChIKey of pyridin-2-yl 4-methylbenzenesulfonate?
The InChIKey is YXCSPMRGMHOTBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3S/c1-10-5-7-11(8-6-10)17(14,15)16-12-4-2-3-9-13-12/h2-9H,1H3.
What are the key properties of pyridin-2-yl 4-methylbenzenesulfonate?
pyridin-2-yl 4-methylbenzenesulfonate has a molecular weight of 249.29 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl 4-methylbenzenesulfonate is sourced from PubChem (CID 11858611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).