C17H24N4O7 — CID 118586127
2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]propanoylamino]propanoylamino]propanoic acid (PubChem CID 118586127) has the molecular formula C17H24N4O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]propanoylamino]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]propanoylamino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 118586127 |
| Molecular Formula | C17H24N4O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]propanoylamino]propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)C(C)NC(=O)C(C)NC(=O)CCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C17H24N4O7/c1-9(15(25)19-10(2)16(26)20-11(3)17(27)28)18-12(22)5-4-8-21-13(23)6-7-14(21)24/h6-7,9-11H,4-5,8H2,1-3H3,(H,18,22)(H,19,25)(H,20,26)(H,27,28) |
| InChIKey | NPRUXNYLIBRNJZ-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|